C16H32N3O2+ — CID 134926939
[3-(ethylamino)-3-oxopropyl]-dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]azanium (PubChem CID 134926939) has the molecular formula C16H32N3O2+ and a molecular weight of 298.45 g/mol. Its IUPAC name is [3-(ethylamino)-3-oxopropyl]-dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]azanium.
| Compound Name | [3-(ethylamino)-3-oxopropyl]-dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]azanium |
|---|---|
| PubChem CID | 134926939 |
| Molecular Formula | C16H32N3O2+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | [3-(ethylamino)-3-oxopropyl]-dimethyl-[3-methyl-3-(2-methylprop-2-enoylamino)butyl]azanium |
| SMILES | C=C(C)C(=O)NC(C)(C)CC[N+](C)(C)CCC(=O)NCC |
| InChI | InChI=1S/C16H31N3O2/c1-8-17-14(20)9-11-19(6,7)12-10-16(4,5)18-15(21)13(2)3/h2,8-12H2,1,3-7H3,(H-,17,18,20,21)/p+1 |
| InChIKey | XKHPSJKFJIRPAC-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|