C16H35ClN2O4Si — CID 22134284
dimethyl-[2-methyl-2-(2-methylprop-2-enoylamino)propyl]-(3-trimethoxysilylpropyl)azanium chloride (PubChem CID 22134284) has the molecular formula C16H35ClN2O4Si and a molecular weight of 383.01 g/mol. Its IUPAC name is dimethyl-[2-methyl-2-(2-methylprop-2-enoylamino)propyl]-(3-trimethoxysilylpropyl)azanium chloride.
| Compound Name | dimethyl-[2-methyl-2-(2-methylprop-2-enoylamino)propyl]-(3-trimethoxysilylpropyl)azanium chloride |
|---|---|
| PubChem CID | 22134284 |
| Molecular Formula | C16H35ClN2O4Si |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | dimethyl-[2-methyl-2-(2-methylprop-2-enoylamino)propyl]-(3-trimethoxysilylpropyl)azanium chloride |
| SMILES | C=C(C)C(=O)NC(C)(C)C[N+](C)(C)CCC[Si](OC)(OC)OC.[Cl-] |
| InChI | InChI=1S/C16H34N2O4Si.ClH/c1-14(2)15(19)17-16(3,4)13-18(5,6)11-10-12-23(20-7,21-8)22-9;/h1,10-13H2,2-9H3;1H |
| InChIKey | CPBLCTUXIXKQCQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|