C16H37ClN2O4SSi — CID 169430479
3-trimethoxysilylpropane-1-thiol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride (PubChem CID 169430479) has the molecular formula C16H37ClN2O4SSi and a molecular weight of 417.09 g/mol. Its IUPAC name is 3-trimethoxysilylpropane-1-thiol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride.
| Compound Name | 3-trimethoxysilylpropane-1-thiol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride |
|---|---|
| PubChem CID | 169430479 |
| Molecular Formula | C16H37ClN2O4SSi |
| Molecular Weight | 417.09 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-trimethoxysilylpropane-1-thiol;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.CO[Si](CCCS)(OC)OC.[Cl-] |
| InChI | InChI=1S/C10H20N2O.C6H16O3SSi.ClH/c1-9(2)10(13)11-7-6-8-12(3,4)5;1-7-11(8-2,9-3)6-4-5-10;/h1,6-8H2,2-5H3;10H,4-6H2,1-3H3;1H |
| InChIKey | SWMMWFVUVZOLPO-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.09 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|