C10H21N2O2+ — CID 87578261
[1-hydroxy-1-(2-methylprop-2-enoylamino)propyl]-trimethylazanium (PubChem CID 87578261) has the molecular formula C10H21N2O2+ and a molecular weight of 201.29 g/mol. Its IUPAC name is [1-hydroxy-1-(2-methylprop-2-enoylamino)propyl]-trimethylazanium.
| Compound Name | [1-hydroxy-1-(2-methylprop-2-enoylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 87578261 |
| Molecular Formula | C10H21N2O2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | [1-hydroxy-1-(2-methylprop-2-enoylamino)propyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)NC(O)(CC)[N+](C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-7-10(14,12(4,5)6)11-9(13)8(2)3/h14H,2,7H2,1,3-6H3/p+1 |
| InChIKey | YUHGDFRCBZAGQX-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|