C16H33N2O+ — CID 18366336
trimethyl-[6-methyl-6-(2-methylprop-2-enoylamino)octan-3-yl]azanium (PubChem CID 18366336) has the molecular formula C16H33N2O+ and a molecular weight of 269.45 g/mol. Its IUPAC name is trimethyl-[6-methyl-6-(2-methylprop-2-enoylamino)octan-3-yl]azanium.
| Compound Name | trimethyl-[6-methyl-6-(2-methylprop-2-enoylamino)octan-3-yl]azanium |
|---|---|
| PubChem CID | 18366336 |
| Molecular Formula | C16H33N2O+ |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.26 |
| IUPAC Name | trimethyl-[6-methyl-6-(2-methylprop-2-enoylamino)octan-3-yl]azanium |
| SMILES | C=C(C)C(=O)NC(C)(CC)CCC(CC)[N+](C)(C)C |
| InChI | InChI=1S/C16H32N2O/c1-9-14(18(6,7)8)11-12-16(5,10-2)17-15(19)13(3)4/h14H,3,9-12H2,1-2,4-8H3/p+1 |
| InChIKey | ZVUPDYUWSWCEKA-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|