C7H11NO5 — CID 150718291
2,3-dihydroxy-2-(2-methylprop-2-enoylamino)propanoic acid (PubChem CID 150718291) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2,3-dihydroxy-2-(2-methylprop-2-enoylamino)propanoic acid.
| Compound Name | 2,3-dihydroxy-2-(2-methylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 150718291 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2,3-dihydroxy-2-(2-methylprop-2-enoylamino)propanoic acid |
| SMILES | C=C(C)C(=O)NC(O)(CO)C(=O)O |
| InChI | InChI=1S/C7H11NO5/c1-4(2)5(10)8-7(13,3-9)6(11)12/h9,13H,1,3H2,2H3,(H,8,10)(H,11,12) |
| InChIKey | JPICVZPFJMZLCH-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|