C13H26N2O4 — CID 173428531
acetic acid;N-[2-(dimethylamino)-1-hydroxypentan-2-yl]-2-methylprop-2-enamide (PubChem CID 173428531) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is acetic acid;N-[2-(dimethylamino)-1-hydroxypentan-2-yl]-2-methylprop-2-enamide.
| Compound Name | acetic acid;N-[2-(dimethylamino)-1-hydroxypentan-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 173428531 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | acetic acid;N-[2-(dimethylamino)-1-hydroxypentan-2-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(CO)(CCC)N(C)C.CC(=O)O |
| InChI | InChI=1S/C11H22N2O2.C2H4O2/c1-6-7-11(8-14,13(4)5)12-10(15)9(2)3;1-2(3)4/h14H,2,6-8H2,1,3-5H3,(H,12,15);1H3,(H,3,4) |
| InChIKey | IIBZWFJVWBLALQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|