C6H9NO2 — CID 174577557
N-(1-hydroxyethenyl)-2-methylprop-2-enamide (PubChem CID 174577557) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is N-(1-hydroxyethenyl)-2-methylprop-2-enamide.
| Compound Name | N-(1-hydroxyethenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174577557 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | N-(1-hydroxyethenyl)-2-methylprop-2-enamide |
| SMILES | C=C(O)NC(=O)C(=C)C |
| InChI | InChI=1S/C6H9NO2/c1-4(2)6(9)7-5(3)8/h8H,1,3H2,2H3,(H,7,9) |
| InChIKey | UTXOMIILNBYROZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|