C7H12N2O2 — CID 20633703
N-[(2S)-2-aminopropanoyl]-2-methylprop-2-enamide (PubChem CID 20633703) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is N-[(2S)-2-aminopropanoyl]-2-methylprop-2-enamide.
| Compound Name | N-[(2S)-2-aminopropanoyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 20633703 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | N-[(2S)-2-aminopropanoyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C7H12N2O2/c1-4(2)6(10)9-7(11)5(3)8/h5H,1,8H2,2-3H3,(H,9,10,11)/t5-/m0/s1 |
| InChIKey | XFYKEDAVOKGAIO-YFKPBYRVSA-N |
| XLogP | -0.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|