C8H13NO4 — CID 18965589
1-methoxyethyl N-(2-methylprop-2-enoyl)carbamate (PubChem CID 18965589) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-methoxyethyl N-(2-methylprop-2-enoyl)carbamate.
| Compound Name | 1-methoxyethyl N-(2-methylprop-2-enoyl)carbamate |
|---|---|
| PubChem CID | 18965589 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-methoxyethyl N-(2-methylprop-2-enoyl)carbamate |
| SMILES | C=C(C)C(=O)NC(=O)OC(C)OC |
| InChI | InChI=1S/C8H13NO4/c1-5(2)7(10)9-8(11)13-6(3)12-4/h6H,1H2,2-4H3,(H,9,10,11) |
| InChIKey | QODRXQWNAZKLKJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|