C6H11NO3 — CID 54452734
N-[hydroxy(methoxy)methyl]-2-methylprop-2-enamide (PubChem CID 54452734) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is N-[hydroxy(methoxy)methyl]-2-methylprop-2-enamide.
| Compound Name | N-[hydroxy(methoxy)methyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 54452734 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N-[hydroxy(methoxy)methyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(O)OC |
| InChI | InChI=1S/C6H11NO3/c1-4(2)5(8)7-6(9)10-3/h6,9H,1H2,2-3H3,(H,7,8) |
| InChIKey | WWBOWCCBSJYLSU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|