C9H13N2O5S- — CID 140789010
bis(2-methylprop-2-enoylamino)methanesulfonate (PubChem CID 140789010) has the molecular formula C9H13N2O5S- and a molecular weight of 261.28 g/mol. Its IUPAC name is bis(2-methylprop-2-enoylamino)methanesulfonate.
| Compound Name | bis(2-methylprop-2-enoylamino)methanesulfonate |
|---|---|
| PubChem CID | 140789010 |
| Molecular Formula | C9H13N2O5S- |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | bis(2-methylprop-2-enoylamino)methanesulfonate |
| SMILES | C=C(C)C(=O)NC(NC(=O)C(=C)C)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H14N2O5S/c1-5(2)7(12)10-9(17(14,15)16)11-8(13)6(3)4/h9H,1,3H2,2,4H3,(H,10,12)(H,11,13)(H,14,15,16)/p-1 |
| InChIKey | PKEQOXMXJOOXQY-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|