C14H27NO4S — CID 87948398
2-(2-methylprop-2-enoylamino)decane-1-sulfonic acid (PubChem CID 87948398) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)decane-1-sulfonic acid.
| Compound Name | 2-(2-methylprop-2-enoylamino)decane-1-sulfonic acid |
|---|---|
| PubChem CID | 87948398 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)decane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)NC(CCCCCCCC)CS(=O)(=O)O |
| InChI | InChI=1S/C14H27NO4S/c1-4-5-6-7-8-9-10-13(11-20(17,18)19)15-14(16)12(2)3/h13H,2,4-11H2,1,3H3,(H,15,16)(H,17,18,19) |
| InChIKey | LCXJJLAULGREJZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|