C19H38N2O — CID 174981821
N-[1-(dodecylamino)propyl]-2-methylprop-2-enamide (PubChem CID 174981821) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is N-[1-(dodecylamino)propyl]-2-methylprop-2-enamide.
| Compound Name | N-[1-(dodecylamino)propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174981821 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | N-[1-(dodecylamino)propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(CC)NCCCCCCCCCCCC |
| InChI | InChI=1S/C19H38N2O/c1-5-7-8-9-10-11-12-13-14-15-16-20-18(6-2)21-19(22)17(3)4/h18,20H,3,5-16H2,1-2,4H3,(H,21,22) |
| InChIKey | ULRMOJPVBUQYNM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|