C16H30N2O5S — CID 18366434
2-[[1-(2-methylprop-2-enoylamino)-10-oxodecyl]amino]ethanesulfonic acid (PubChem CID 18366434) has the molecular formula C16H30N2O5S and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[[1-(2-methylprop-2-enoylamino)-10-oxodecyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[1-(2-methylprop-2-enoylamino)-10-oxodecyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 18366434 |
| Molecular Formula | C16H30N2O5S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[[1-(2-methylprop-2-enoylamino)-10-oxodecyl]amino]ethanesulfonic acid |
| SMILES | C=C(C)C(=O)NC(CCCCCCCCC=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C16H30N2O5S/c1-14(2)16(20)18-15(17-11-13-24(21,22)23)10-8-6-4-3-5-7-9-12-19/h12,15,17H,1,3-11,13H2,2H3,(H,18,20)(H,21,22,23) |
| InChIKey | JJKGSHVOLPUGFG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|