C20H36N2O2 — CID 175297760
2-methyl-N-[9-(2-methylprop-2-enoylamino)dodecan-4-yl]prop-2-enamide (PubChem CID 175297760) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-methyl-N-[9-(2-methylprop-2-enoylamino)dodecan-4-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[9-(2-methylprop-2-enoylamino)dodecan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175297760 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 2-methyl-N-[9-(2-methylprop-2-enoylamino)dodecan-4-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NC(CCC)CCCCC(CCC)NC(=O)C(=C)C |
| InChI | InChI=1S/C20H36N2O2/c1-7-11-17(21-19(23)15(3)4)13-9-10-14-18(12-8-2)22-20(24)16(5)6/h17-18H,3,5,7-14H2,1-2,4,6H3,(H,21,23)(H,22,24) |
| InChIKey | IHDXLORTEGWHPU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|