C23H41NO — CID 155036913
N-(14-methyl-8,13-dimethylidene-9-propylpentadec-14-en-4-yl)acetamide (PubChem CID 155036913) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is N-(14-methyl-8,13-dimethylidene-9-propylpentadec-14-en-4-yl)acetamide.
| Compound Name | N-(14-methyl-8,13-dimethylidene-9-propylpentadec-14-en-4-yl)acetamide |
|---|---|
| PubChem CID | 155036913 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | N-(14-methyl-8,13-dimethylidene-9-propylpentadec-14-en-4-yl)acetamide |
| SMILES | C=C(C)C(=C)CCCC(CCC)C(=C)CCCC(CCC)NC(C)=O |
| InChI | InChI=1S/C23H41NO/c1-8-12-22(16-10-14-19(5)18(3)4)20(6)15-11-17-23(13-9-2)24-21(7)25/h22-23H,3,5-6,8-17H2,1-2,4,7H3,(H,24,25) |
| InChIKey | GFFYZWOYZPIQOD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|