C15H26N2O4 — CID 106019806
2,3-dimethyl-4-(octan-4-ylcarbamoylamino)-4-oxobut-2-enoic acid (PubChem CID 106019806) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,3-dimethyl-4-(octan-4-ylcarbamoylamino)-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-(octan-4-ylcarbamoylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 106019806 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2,3-dimethyl-4-(octan-4-ylcarbamoylamino)-4-oxobut-2-enoic acid |
| SMILES | CCCCC(CCC)NC(=O)NC(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C15H26N2O4/c1-5-7-9-12(8-6-2)16-15(21)17-13(18)10(3)11(4)14(19)20/h12H,5-9H2,1-4H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | RXLVKOQLORXVOQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|