C16H32N2O3 — CID 106020545
2,2,3-trimethyl-3-(octan-4-ylcarbamoylamino)butanoic acid (PubChem CID 106020545) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(octan-4-ylcarbamoylamino)butanoic acid.
| Compound Name | 2,2,3-trimethyl-3-(octan-4-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106020545 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 2,2,3-trimethyl-3-(octan-4-ylcarbamoylamino)butanoic acid |
| SMILES | CCCCC(CCC)NC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C16H32N2O3/c1-7-9-11-12(10-8-2)17-14(21)18-16(5,6)15(3,4)13(19)20/h12H,7-11H2,1-6H3,(H,19,20)(H2,17,18,21) |
| InChIKey | GRQOODHACKCAAS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |