C14H28N2O3 — CID 65265326
3-(hexylcarbamoylamino)-2,2,3-trimethylbutanoic acid (PubChem CID 65265326) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-(hexylcarbamoylamino)-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-(hexylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265326 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 3-(hexylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
| SMILES | CCCCCCNC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H28N2O3/c1-6-7-8-9-10-15-12(19)16-14(4,5)13(2,3)11(17)18/h6-10H2,1-5H3,(H,17,18)(H2,15,16,19) |
| InChIKey | DCPVTBRBBUYARH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|