C15H30N2O4 — CID 106004455
2,2,3-trimethyl-3-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid (PubChem CID 106004455) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid.
| Compound Name | 2,2,3-trimethyl-3-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106004455 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2,2,3-trimethyl-3-(4-propan-2-yloxybutylcarbamoylamino)butanoic acid |
| SMILES | CC(C)OCCCCNC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H30N2O4/c1-11(2)21-10-8-7-9-16-13(20)17-15(5,6)14(3,4)12(18)19/h11H,7-10H2,1-6H3,(H,18,19)(H2,16,17,20) |
| InChIKey | WPEJFTFZTJINQO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|