C12H23N3O4 — CID 65266386
3-(2-acetamidoethylcarbamoylamino)-2,2,3-trimethylbutanoic acid (PubChem CID 65266386) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-(2-acetamidoethylcarbamoylamino)-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-(2-acetamidoethylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65266386 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-(2-acetamidoethylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
| SMILES | CC(=O)NCCNC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-8(16)13-6-7-14-10(19)15-12(4,5)11(2,3)9(17)18/h6-7H2,1-5H3,(H,13,16)(H,17,18)(H2,14,15,19) |
| InChIKey | DGBACNHPHAOWEF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|