C10H22N2O2 — CID 103993631
N-[2-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]ethyl]acetamide (PubChem CID 103993631) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[2-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 103993631 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N-[2-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C10H22N2O2/c1-8(13)11-6-7-12-9(2,3)10(4,5)14/h12,14H,6-7H2,1-5H3,(H,11,13) |
| InChIKey | KKIGMJWVBXOJNJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|