C14H27N3O3 — CID 65266295
3-[3-(cyclopropylamino)propylcarbamoylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 65266295) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[3-(cyclopropylamino)propylcarbamoylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[3-(cyclopropylamino)propylcarbamoylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65266295 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-[3-(cyclopropylamino)propylcarbamoylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)NCCCNC1CC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H27N3O3/c1-13(2,11(18)19)14(3,4)17-12(20)16-9-5-8-15-10-6-7-10/h10,15H,5-9H2,1-4H3,(H,18,19)(H2,16,17,20) |
| InChIKey | YXXYMSWCLHYOCB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|