C15H26F6N2O — CID 71672034
1-decyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea (PubChem CID 71672034) has the molecular formula C15H26F6N2O and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-decyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea.
| Compound Name | 1-decyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 71672034 |
| Molecular Formula | C15H26F6N2O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-decyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
| SMILES | CCCCCCCCCCNC(=O)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H26F6N2O/c1-3-4-5-6-7-8-9-10-11-22-12(24)23-13(2,14(16,17)18)15(19,20)21/h3-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | PVFRCEUSWUHFQA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|