C16H27F6NO — CID 5023706
N-decyl-2,2-bis(trifluoromethyl)butanamide (PubChem CID 5023706) has the molecular formula C16H27F6NO and a molecular weight of 363.39 g/mol. Its IUPAC name is N-decyl-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-decyl-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 5023706 |
| Molecular Formula | C16H27F6NO |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-decyl-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCCCCCCCCCNC(=O)C(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H27F6NO/c1-3-5-6-7-8-9-10-11-12-23-13(24)14(4-2,15(17,18)19)16(20,21)22/h3-12H2,1-2H3,(H,23,24) |
| InChIKey | PEZPTOXCRDAIOZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|