C9H13F6NO — CID 71671965
N-propyl-2,2-bis(trifluoromethyl)butanamide (PubChem CID 71671965) has the molecular formula C9H13F6NO and a molecular weight of 265.20 g/mol. Its IUPAC name is N-propyl-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-propyl-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 71671965 |
| Molecular Formula | C9H13F6NO |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-propyl-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCCNC(=O)C(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F6NO/c1-3-5-16-6(17)7(4-2,8(10,11)12)9(13,14)15/h3-5H2,1-2H3,(H,16,17) |
| InChIKey | JVPXUTCUYPMXQH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |