C9H11F6NO — CID 71671966
N-prop-2-enyl-2,2-bis(trifluoromethyl)butanamide (PubChem CID 71671966) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is N-prop-2-enyl-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-prop-2-enyl-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 71671966 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-prop-2-enyl-2,2-bis(trifluoromethyl)butanamide |
| SMILES | C=CCNC(=O)C(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F6NO/c1-3-5-16-6(17)7(4-2,8(10,11)12)9(13,14)15/h3H,1,4-5H2,2H3,(H,16,17) |
| InChIKey | FYVFDVLTZNDFBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|