C6H6F5NO2 — CID 166497913
[1,1,1,2-tetrafluoro-3-oxo-3-(prop-2-enylamino)propan-2-yl] hypofluorite (PubChem CID 166497913) has the molecular formula C6H6F5NO2 and a molecular weight of 219.11 g/mol. Its IUPAC name is [1,1,1,2-tetrafluoro-3-oxo-3-(prop-2-enylamino)propan-2-yl] hypofluorite.
| Compound Name | [1,1,1,2-tetrafluoro-3-oxo-3-(prop-2-enylamino)propan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 166497913 |
| Molecular Formula | C6H6F5NO2 |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | [1,1,1,2-tetrafluoro-3-oxo-3-(prop-2-enylamino)propan-2-yl] hypofluorite |
| SMILES | C=CCNC(=O)C(F)(OF)C(F)(F)F |
| InChI | InChI=1S/C6H6F5NO2/c1-2-3-12-4(13)5(7,14-11)6(8,9)10/h2H,1,3H2,(H,12,13) |
| InChIKey | CLRJJGRRTVXECT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|