C15H29NO — CID 156569078
2-tert-butyl-2,4,4-trimethyl-N-prop-2-enylpentanamide (PubChem CID 156569078) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2-tert-butyl-2,4,4-trimethyl-N-prop-2-enylpentanamide.
| Compound Name | 2-tert-butyl-2,4,4-trimethyl-N-prop-2-enylpentanamide |
|---|---|
| PubChem CID | 156569078 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2-tert-butyl-2,4,4-trimethyl-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO/c1-9-10-16-12(17)15(8,14(5,6)7)11-13(2,3)4/h9H,1,10-11H2,2-8H3,(H,16,17) |
| InChIKey | DZAOWQLYTGNXEV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|