C26H50O2W — CID 158863918
bis(3-tert-butyl-3,5,5-trimethylhexan-2-one);tungsten(2+) (PubChem CID 158863918) has the molecular formula C26H50O2W and a molecular weight of 578.52 g/mol. Its IUPAC name is bis(3-tert-butyl-3,5,5-trimethylhexan-2-one);tungsten(2+).
| Compound Name | bis(3-tert-butyl-3,5,5-trimethylhexan-2-one);tungsten(2+) |
|---|---|
| PubChem CID | 158863918 |
| Molecular Formula | C26H50O2W |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | bis(3-tert-butyl-3,5,5-trimethylhexan-2-one);tungsten(2+) |
| SMILES | [CH2-]C(=O)C(C)(CC(C)(C)C)C(C)(C)C.[CH2-]C(=O)C(C)(CC(C)(C)C)C(C)(C)C.[W+2] |
| InChI | InChI=1S/2C13H25O.W/c2*1-10(14)13(8,12(5,6)7)9-11(2,3)4;/h2*1,9H2,2-8H3;/q2*-1;+2 |
| InChIKey | JAZHFBKDYTUSOL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|