C13H26NO3+ — CID 148557065
(2-tert-butyl-2,4,4-trimethylpentanoyl)oxycarbonylazanium (PubChem CID 148557065) has the molecular formula C13H26NO3+ and a molecular weight of 244.35 g/mol. Its IUPAC name is (2-tert-butyl-2,4,4-trimethylpentanoyl)oxycarbonylazanium.
| Compound Name | (2-tert-butyl-2,4,4-trimethylpentanoyl)oxycarbonylazanium |
|---|---|
| PubChem CID | 148557065 |
| Molecular Formula | C13H26NO3+ |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2-tert-butyl-2,4,4-trimethylpentanoyl)oxycarbonylazanium |
| SMILES | CC(C)(C)CC(C)(C(=O)OC([NH3+])=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-11(2,3)8-13(7,12(4,5)6)9(15)17-10(14)16/h8H2,1-7H3,(H2,14,16)/p+1 |
| InChIKey | MUGSEOMNQKRUMU-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|