C18H29F3O6 — CID 129191468
[2-oxo-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]ethyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 129191468) has the molecular formula C18H29F3O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is [2-oxo-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]ethyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [2-oxo-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]ethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 129191468 |
| Molecular Formula | C18H29F3O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-oxo-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]ethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(=O)OCC(=O)OCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C18H29F3O6/c1-15(2,3)10-17(7,16(4,5)6)14(24)26-9-12(22)25-8-13(23)27-11-18(19,20)21/h8-11H2,1-7H3 |
| InChIKey | PLXGOTPUCGEENM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|