C13H19F3O5 — CID 167546988
[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2,2-dimethylpropoxymethyl)prop-2-enoate (PubChem CID 167546988) has the molecular formula C13H19F3O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2,2-dimethylpropoxymethyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2,2-dimethylpropoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 167546988 |
| Molecular Formula | C13H19F3O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2,2-dimethylpropoxymethyl)prop-2-enoate |
| SMILES | C=C(COCC(C)(C)C)C(=O)OCC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H19F3O5/c1-9(5-19-7-12(2,3)4)11(18)20-6-10(17)21-8-13(14,15)16/h1,5-8H2,2-4H3 |
| InChIKey | DSJXBAHMDRTNDV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|