C9H11F5O3 — CID 139681010
ethyl 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-enoate (PubChem CID 139681010) has the molecular formula C9H11F5O3 and a molecular weight of 262.17 g/mol. Its IUPAC name is ethyl 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-enoate.
| Compound Name | ethyl 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139681010 |
| Molecular Formula | C9H11F5O3 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | ethyl 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-enoate |
| SMILES | C=C(COCC(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C9H11F5O3/c1-3-17-7(15)6(2)4-16-5-8(10,11)9(12,13)14/h2-5H2,1H3 |
| InChIKey | QABFSUJOEPBDKH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|