C10H12F6O4 — CID 168844951
ethyl 2-[[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]methyl]prop-2-enoate (PubChem CID 168844951) has the molecular formula C10H12F6O4 and a molecular weight of 310.19 g/mol. Its IUPAC name is ethyl 2-[[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 168844951 |
| Molecular Formula | C10H12F6O4 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | ethyl 2-[[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]methyl]prop-2-enoate |
| SMILES | C=C(COCC(O)(C(F)(F)F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C10H12F6O4/c1-3-20-7(17)6(2)4-19-5-8(18,9(11,12)13)10(14,15)16/h18H,2-5H2,1H3 |
| InChIKey | FSKRUOVJCYKQTQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|