C18H30O5 — CID 139630888
2,2-dimethylpropyl 2-[2-(2,2-dimethylpropoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate (PubChem CID 139630888) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[2-(2,2-dimethylpropoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate.
| Compound Name | 2,2-dimethylpropyl 2-[2-(2,2-dimethylpropoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 139630888 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2,2-dimethylpropyl 2-[2-(2,2-dimethylpropoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate |
| SMILES | C=C(COCC(=C)C(=O)OCC(C)(C)C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H30O5/c1-13(15(19)22-11-17(3,4)5)9-21-10-14(2)16(20)23-12-18(6,7)8/h1-2,9-12H2,3-8H3 |
| InChIKey | LOOCGSIAADROOV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|