C11H20O4 — CID 175512775
2-(2,2-dimethylpropoxy)ethyl 2-methoxyprop-2-enoate (PubChem CID 175512775) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)ethyl 2-methoxyprop-2-enoate.
| Compound Name | 2-(2,2-dimethylpropoxy)ethyl 2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 175512775 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)ethyl 2-methoxyprop-2-enoate |
| SMILES | C=C(OC)C(=O)OCCOCC(C)(C)C |
| InChI | InChI=1S/C11H20O4/c1-9(13-5)10(12)15-7-6-14-8-11(2,3)4/h1,6-8H2,2-5H3 |
| InChIKey | DYAFQSFBEMHVNG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|