C10H17BrO4 — CID 87178004
2-(2-bromooxy-2-methylpropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 87178004) has the molecular formula C10H17BrO4 and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-(2-bromooxy-2-methylpropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-bromooxy-2-methylpropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87178004 |
| Molecular Formula | C10H17BrO4 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(2-bromooxy-2-methylpropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(C)(C)OBr |
| InChI | InChI=1S/C10H17BrO4/c1-8(2)9(12)14-6-5-13-7-10(3,4)15-11/h1,5-7H2,2-4H3 |
| InChIKey | MYZYJKBQPUFBHJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|