C15H24F3IO4 — CID 146323971
[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2-iodopropan-2-yl)-2,4,4-trimethylpentanoate (PubChem CID 146323971) has the molecular formula C15H24F3IO4 and a molecular weight of 452.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2-iodopropan-2-yl)-2,4,4-trimethylpentanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2-iodopropan-2-yl)-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 146323971 |
| Molecular Formula | C15H24F3IO4 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-(2-iodopropan-2-yl)-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(=O)OCC(F)(F)F)C(C)(C)I |
| InChI | InChI=1S/C15H24F3IO4/c1-12(2,3)8-14(6,13(4,5)19)11(21)22-7-10(20)23-9-15(16,17)18/h7-9H2,1-6H3 |
| InChIKey | UHUTXJMUQOLZDT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|