C21H38O5 — CID 123322640
[2-(cyclohexyloxymethoxy)-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123322640) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is [2-(cyclohexyloxymethoxy)-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [2-(cyclohexyloxymethoxy)-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123322640 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [2-(cyclohexyloxymethoxy)-2-oxoethyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(=O)OCOC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C21H38O5/c1-19(2,3)14-21(7,20(4,5)6)18(23)24-13-17(22)26-15-25-16-11-9-8-10-12-16/h16H,8-15H2,1-7H3 |
| InChIKey | SDYZXQQIBYRQBB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|