C22H36O5 — CID 122499988
cyclohexyloxymethyl 6-(4,4-dimethylpentanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 122499988) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is cyclohexyloxymethyl 6-(4,4-dimethylpentanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | cyclohexyloxymethyl 6-(4,4-dimethylpentanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 122499988 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | cyclohexyloxymethyl 6-(4,4-dimethylpentanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)CCC(=O)OC1CC2CC(C(=O)OCOC3CCCCC3)C1C2 |
| InChI | InChI=1S/C22H36O5/c1-22(2,3)10-9-20(23)27-19-13-15-11-17(19)18(12-15)21(24)26-14-25-16-7-5-4-6-8-16/h15-19H,4-14H2,1-3H3 |
| InChIKey | ZFCMHCXJJWDWIF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|