About cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate
cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate (PubChem CID 89178632) has the molecular formula C22H38O5
and a molecular weight of 382.54 g/mol. Its IUPAC name is cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate |
| PubChem CID | 89178632 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)CCC(=O)OC1CCCC(C(=O)OCOCC2CCCCC2)C1 |
| InChI | InChI=1S/C22H38O5/c1-22(2,3)13-12-20(23)27-19-11-7-10-18(14-19)21(24)26-16-25-15-17-8-5-4-6-9-17/h17-19H,4-16H2,1-3H3 |
| InChIKey | DEHKQLOLZXPHIW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate?
The IUPAC name of cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate (CID 89178632) is cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate.
What is the SMILES notation for cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate?
The canonical SMILES for cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate is CC(C)(C)CCC(=O)OC1CCCC(C(=O)OCOCC2CCCCC2)C1.
What is the InChIKey of cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate?
The InChIKey is DEHKQLOLZXPHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O5/c1-22(2,3)13-12-20(23)27-19-11-7-10-18(14-19)21(24)26-16-25-15-17-8-5-4-6-9-17/h17-19H,4-16H2,1-3H3.
What are the key properties of cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate?
cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate has a molecular weight of 382.54 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethoxymethyl 3-(4,4-dimethylpentanoyloxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 89178632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).