About 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid
4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid (PubChem CID 71171401) has the molecular formula C14H22O6
and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid.
Molecular Properties
| Compound Name | 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid |
| PubChem CID | 71171401 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid |
| SMILES | CC(C)OC(=O)[C@H]1CCC[C@@H](OC(=O)CCC(=O)O)C1 |
| InChI | InChI=1S/C14H22O6/c1-9(2)19-14(18)10-4-3-5-11(8-10)20-13(17)7-6-12(15)16/h9-11H,3-8H2,1-2H3,(H,15,16)/t10-,11+/m0/s1 |
| InChIKey | IYTWXKDYJHBWNI-WDEREUQCSA-N |
| XLogP | 1.90 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid?
The IUPAC name of 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid (CID 71171401) is 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid.
What is the SMILES notation for 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid?
The canonical SMILES for 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid is CC(C)OC(=O)[C@H]1CCC[C@@H](OC(=O)CCC(=O)O)C1.
What is the InChIKey of 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid?
The InChIKey is IYTWXKDYJHBWNI-WDEREUQCSA-N. The full InChI is InChI=1S/C14H22O6/c1-9(2)19-14(18)10-4-3-5-11(8-10)20-13(17)7-6-12(15)16/h9-11H,3-8H2,1-2H3,(H,15,16)/t10-,11+/m0/s1.
What are the key properties of 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid?
4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid has a molecular weight of 286.32 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-[(1R,3S)-3-propan-2-yloxycarbonylcyclohexyl]oxybutanoic acid is sourced from PubChem (CID 71171401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).