C16H20BrFO3 — CID 166853099
propan-2-yl (1S)-3-(4-bromo-2-fluorophenoxy)cyclohexane-1-carboxylate (PubChem CID 166853099) has the molecular formula C16H20BrFO3 and a molecular weight of 359.24 g/mol. Its IUPAC name is propan-2-yl (1S)-3-(4-bromo-2-fluorophenoxy)cyclohexane-1-carboxylate.
| Compound Name | propan-2-yl (1S)-3-(4-bromo-2-fluorophenoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166853099 |
| Molecular Formula | C16H20BrFO3 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | propan-2-yl (1S)-3-(4-bromo-2-fluorophenoxy)cyclohexane-1-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1CCCC(Oc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C16H20BrFO3/c1-10(2)20-16(19)11-4-3-5-13(8-11)21-15-7-6-12(17)9-14(15)18/h6-7,9-11,13H,3-5,8H2,1-2H3/t11-,13?/m0/s1 |
| InChIKey | WLBPJTPWWJBMJS-AMGKYWFPSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |