C15H21BrO3 — CID 78958654
(1S)-1-[5-bromo-2-(3-methoxycyclohexyl)oxyphenyl]ethanol (PubChem CID 78958654) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is (1S)-1-[5-bromo-2-(3-methoxycyclohexyl)oxyphenyl]ethanol.
| Compound Name | (1S)-1-[5-bromo-2-(3-methoxycyclohexyl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 78958654 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (1S)-1-[5-bromo-2-(3-methoxycyclohexyl)oxyphenyl]ethanol |
| SMILES | COC1CCCC(Oc2ccc(Br)cc2[C@H](C)O)C1 |
| InChI | InChI=1S/C15H21BrO3/c1-10(17)14-8-11(16)6-7-15(14)19-13-5-3-4-12(9-13)18-2/h6-8,10,12-13,17H,3-5,9H2,1-2H3/t10-,12?,13?/m0/s1 |
| InChIKey | VVFBVNNXRMXCAF-PKSQDBQZSA-N |
| XLogP | 3.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |