C15H22O3 — CID 78958662
(1S)-1-[2-(3-methoxycyclohexyl)oxyphenyl]ethanol (PubChem CID 78958662) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S)-1-[2-(3-methoxycyclohexyl)oxyphenyl]ethanol.
| Compound Name | (1S)-1-[2-(3-methoxycyclohexyl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 78958662 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S)-1-[2-(3-methoxycyclohexyl)oxyphenyl]ethanol |
| SMILES | COC1CCCC(Oc2ccccc2[C@H](C)O)C1 |
| InChI | InChI=1S/C15H22O3/c1-11(16)14-8-3-4-9-15(14)18-13-7-5-6-12(10-13)17-2/h3-4,8-9,11-13,16H,5-7,10H2,1-2H3/t11-,12?,13?/m0/s1 |
| InChIKey | HASZJAHVVCLIAO-HIFPTAJRSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |