C16H24O2 — CID 78999226
(1R)-1-[2-(3,5-dimethylcyclohexyl)oxyphenyl]ethanol (PubChem CID 78999226) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R)-1-[2-(3,5-dimethylcyclohexyl)oxyphenyl]ethanol.
| Compound Name | (1R)-1-[2-(3,5-dimethylcyclohexyl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 78999226 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R)-1-[2-(3,5-dimethylcyclohexyl)oxyphenyl]ethanol |
| SMILES | CC1CC(C)CC(Oc2ccccc2[C@@H](C)O)C1 |
| InChI | InChI=1S/C16H24O2/c1-11-8-12(2)10-14(9-11)18-16-7-5-4-6-15(16)13(3)17/h4-7,11-14,17H,8-10H2,1-3H3/t11?,12?,13-,14?/m1/s1 |
| InChIKey | LQEJRJJJJQBSAM-WCFLAILDSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |