About 1-cycloheptyl-4,4-dimethylpentan-1-one
1-cycloheptyl-4,4-dimethylpentan-1-one (PubChem CID 65399769) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-cycloheptyl-4,4-dimethylpentan-1-one.
Molecular Properties
| Compound Name | 1-cycloheptyl-4,4-dimethylpentan-1-one |
| PubChem CID | 65399769 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-cycloheptyl-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)C1CCCCCC1 |
| InChI | InChI=1S/C14H26O/c1-14(2,3)11-10-13(15)12-8-6-4-5-7-9-12/h12H,4-11H2,1-3H3 |
| InChIKey | LHQMKNSJSDFENF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cycloheptyl-4,4-dimethylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-4,4-dimethylpentan-1-one?
The IUPAC name of 1-cycloheptyl-4,4-dimethylpentan-1-one (CID 65399769) is 1-cycloheptyl-4,4-dimethylpentan-1-one.
What is the SMILES notation for 1-cycloheptyl-4,4-dimethylpentan-1-one?
The canonical SMILES for 1-cycloheptyl-4,4-dimethylpentan-1-one is CC(C)(C)CCC(=O)C1CCCCCC1.
What is the InChIKey of 1-cycloheptyl-4,4-dimethylpentan-1-one?
The InChIKey is LHQMKNSJSDFENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-14(2,3)11-10-13(15)12-8-6-4-5-7-9-12/h12H,4-11H2,1-3H3.
What are the key properties of 1-cycloheptyl-4,4-dimethylpentan-1-one?
1-cycloheptyl-4,4-dimethylpentan-1-one has a molecular weight of 210.36 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-4,4-dimethylpentan-1-one is sourced from PubChem (CID 65399769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).