C13H22F2O — CID 105093364
1-(4,4-difluorocyclohexyl)-4,4-dimethylpentan-1-one (PubChem CID 105093364) has the molecular formula C13H22F2O and a molecular weight of 232.31 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 105093364 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H22F2O/c1-12(2,3)7-6-11(16)10-4-8-13(14,15)9-5-10/h10H,4-9H2,1-3H3 |
| InChIKey | YWNYXHAHDFKSPS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |